Difference between revisions of "5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY"

Revision as of 14:54, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER ==
+== Metabolite CPD-7003 ==
+* common-name:
+** tetrahydrogeranylgeranyl diphosphate
 * smiles:
-** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
+** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
-* common-name:
+* inchi-key:
-** magnesium-protoporphyrin ix 13-monomethyl ester
+** vzbgwadxujsbti-pyddkjgssa-k
 * molecular-weight:
-** 597.975
+** 451.456
 == Reaction(s) known to consume the compound ==
+* [[RXN-7659]]
+* [[RXN-7660]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+* [[RXN-7659]]
+* [[RXN-7660]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=magnesium-protoporphyrin ix 13-monomethyl ester}}
+{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
-{{#set: molecular-weight=597.975}}
+{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
+{{#set: molecular-weight=451.456}}