Difference between revisions of "SINAPOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-acetyl-D-glucosamine == * common-name: ** n-acetyl-d-glucosamine == Reaction(s) known to consume the compound == * N-ACETYLLACTOSAMIN...") |
(Created page with "Category:metabolite == Metabolite PORPHOBILINOGEN == * common-name: ** porphobilinogen * smiles: ** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+] * inchi-key: ** qshwiqzfgqk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PORPHOBILINOGEN == |
* common-name: | * common-name: | ||
| − | ** n- | + | ** porphobilinogen |
| + | * smiles: | ||
| + | ** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+] | ||
| + | * inchi-key: | ||
| + | ** qshwiqzfgqkfma-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 225.224 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OHMETHYLBILANESYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PORPHOBILSYNTH-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=porphobilinogen}} |
| + | {{#set: inchi-key=inchikey=qshwiqzfgqkfma-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=225.224}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite PORPHOBILINOGEN
- common-name:
- porphobilinogen
- smiles:
- c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+]
- inchi-key:
- qshwiqzfgqkfma-uhfffaoysa-m
- molecular-weight:
- 225.224
