Difference between revisions of "A-5-prime-PP-5-prime-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-95 == * common-name: ** gibberellin a12 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-476 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-(2-aminophenyl)-2,4-dioxobutanoate |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** caovwyzqmpnafj-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.177 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.6.1.7-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.6.1.7-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.177}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-476
- common-name:
- 4-(2-aminophenyl)-2,4-dioxobutanoate
- smiles:
- c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
- inchi-key:
- caovwyzqmpnafj-uhfffaoysa-m
- molecular-weight:
- 206.177
