Difference between revisions of "CPD-8355"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == * common-name: ** udp-β-l-threo-pentapyranos-4-ulose * smiles: ** c3(oc(op(=o)([o-])op(=o)...")
(Created page with "Category:metabolite == Metabolite MANNOSE == * common-name: ** d-mannose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- ==
+
== Metabolite MANNOSE ==
 
* common-name:
 
* common-name:
** udp-β-l-threo-pentapyranos-4-ulose
+
** d-mannose
* smiles:
 
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
 
* inchi-key:
 
** urjziqltpcjvmw-qnsckltrsa-l
 
* molecular-weight:
 
** 532.247
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1863]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1863]]
+
* [[3.2.1.113-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}}
+
{{#set: common-name=d-mannose}}
{{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}}
 
{{#set: molecular-weight=532.247}}
 

Revision as of 14:55, 5 January 2021

Metabolite MANNOSE

  • common-name:
    • d-mannose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality