Difference between revisions of "GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12601 == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-rwopyejcsa-n...") |
(Created page with "Category:metabolite == Metabolite BUTYRIC_ACID == * common-name: ** butanoate * smiles: ** cccc(=o)[o-] * inchi-key: ** feriucnnqqjtoy-uhfffaoysa-m * molecular-weight: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BUTYRIC_ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** butanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** feriucnnqqjtoy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 87.098 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12086]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=butanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=feriucnnqqjtoy-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=87.098}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite BUTYRIC_ACID
- common-name:
- butanoate
- smiles:
- cccc(=o)[o-]
- inchi-key:
- feriucnnqqjtoy-uhfffaoysa-m
- molecular-weight:
- 87.098