Difference between revisions of "OXALATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: ** ujlxyodchael...") |
(Created page with "Category:metabolite == Metabolite I-antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite I-antigens == |
* common-name: | * common-name: | ||
| − | ** | + | ** an i antigen |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15278]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an i antigen}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite I-antigens
- common-name:
- an i antigen
