Difference between revisions of "CPD-9861"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15651 == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite Resolution-of-Recombinational-Junction == * common-name: ** resolution of recombinational junction formation of two intact strands == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15651 ==
+
== Metabolite Resolution-of-Recombinational-Junction ==
 
* common-name:
 
* common-name:
** 6-trans-tridecenoyl-coa
+
** resolution of recombinational junction formation of two intact strands
* smiles:
 
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** uuivzebypbpkll-hmxwsvnbsa-j
 
* molecular-weight:
 
** 957.819
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14785]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.22.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-tridecenoyl-coa}}
+
{{#set: common-name=resolution of recombinational junction formation of two intact strands}}
{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
 
{{#set: molecular-weight=957.819}}
 

Revision as of 14:55, 5 January 2021

Metabolite Resolution-of-Recombinational-Junction

  • common-name:
    • resolution of recombinational junction formation of two intact strands

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality