Difference between revisions of "ANDROST4ENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...")
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRONEOPTERIN-P ==
+
== Metabolite Keratan-sulfate-NAcGlcN6S ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin 3'-phosphate
+
** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
* smiles:
 
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
 
* inchi-key:
 
** plsqmgzyogsoce-xinawcovsa-l
 
* molecular-weight:
 
** 333.197
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
* [[RXN-11570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
+
{{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
 
{{#set: molecular-weight=333.197}}
 

Revision as of 14:55, 5 January 2021

Metabolite Keratan-sulfate-NAcGlcN6S

  • common-name:
    • [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.