Difference between revisions of "L-THYROXINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...")
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Keratan-sulfate-NAcGlcN6S ==
+
== Metabolite CPD-367 ==
 
* common-name:
 
* common-name:
** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
+
** (2r)-3-sulfolactate
 +
* smiles:
 +
** c(=o)([o-])c(o)cs([o-])(=o)=o
 +
* inchi-key:
 +
** cqqgiwjsicouon-reohclbhsa-l
 +
* molecular-weight:
 +
** 168.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11570]]
+
* [[R230-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R230-RXN]]
 +
* [[RXN-11727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
+
{{#set: common-name=(2r)-3-sulfolactate}}
 +
{{#set: inchi-key=inchikey=cqqgiwjsicouon-reohclbhsa-l}}
 +
{{#set: molecular-weight=168.121}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-367

  • common-name:
    • (2r)-3-sulfolactate
  • smiles:
    • c(=o)([o-])c(o)cs([o-])(=o)=o
  • inchi-key:
    • cqqgiwjsicouon-reohclbhsa-l
  • molecular-weight:
    • 168.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality