Difference between revisions of "1-Stearoyl-L-Phosphatidate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
(Created page with "Category:metabolite == Metabolite CPDMETA-13651 == * common-name: ** perakine * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6))))) * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14928 ==
+
== Metabolite CPDMETA-13651 ==
 
* common-name:
 
* common-name:
** phytenoyl-coa
+
** perakine
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
 
* inchi-key:
 
* inchi-key:
** nyzpdfuazacyot-peaqseffsa-j
+
** gdxjmogwonjrhl-vqhwpedhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1056.006
+
** 350.416
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-482]]
+
* [[RXN-12673]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-480]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytenoyl-coa}}
+
{{#set: common-name=perakine}}
{{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}}
+
{{#set: inchi-key=inchikey=gdxjmogwonjrhl-vqhwpedhsa-n}}
{{#set: molecular-weight=1056.006}}
+
{{#set: molecular-weight=350.416}}

Revision as of 14:55, 5 January 2021

Metabolite CPDMETA-13651

  • common-name:
    • perakine
  • smiles:
    • cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
  • inchi-key:
    • gdxjmogwonjrhl-vqhwpedhsa-n
  • molecular-weight:
    • 350.416

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality