Difference between revisions of "DEAMIDO-NAD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...")
(Created page with "Category:metabolite == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == * common-name: ** rnase ii substrate with no poly-a tail == Reaction(s) known to consume the co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEAMIDO-NAD ==
+
== Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL ==
 
* common-name:
 
* common-name:
** nicotinate adenine dinucleotide
+
** rnase ii substrate with no poly-a tail
* smiles:
 
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 
* inchi-key:
 
** senpvezbrzqvst-hisdbwnosa-l
 
* molecular-weight:
 
** 662.399
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAD-SYNTH-GLN-RXN]]
 
* [[NAD-SYNTH-NH3-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[RXN0-6524]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nicotinate adenine dinucleotide}}
+
{{#set: common-name=rnase ii substrate with no poly-a tail}}
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
 
{{#set: molecular-weight=662.399}}
 

Revision as of 14:56, 5 January 2021

Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL

  • common-name:
    • rnase ii substrate with no poly-a tail

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality