Difference between revisions of "PHOSPHORIBOSYL-ATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-L-GLUTAMYL-PEPTIDE == * common-name: ** a 5-l-glutamyl-[peptide] == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRAN...")
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-L-GLUTAMYL-PEPTIDE ==
+
== Metabolite CPD-1107 ==
 
* common-name:
 
* common-name:
** a 5-l-glutamyl-[peptide]
+
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** ctpqaxvnygzuaj-kxxvrosksa-d
 +
* molecular-weight:
 +
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
+
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7163]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[RXN-10963]]
 +
* [[RXN-13197]]
 +
* [[RXN-7162]]
 +
* [[RXN-7184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-l-glutamyl-[peptide]}}
+
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
 +
{{#set: molecular-weight=569.977}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-1107

  • common-name:
    • d-myo-inositol 1,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-kxxvrosksa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality