Difference between revisions of "STRICTOSIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRINOGEN ==
+
== Metabolite CPD-8268 ==
 
* common-name:
 
* common-name:
** protoporphyrinogen ix
+
** dioleoyl phosphatidate
 
* smiles:
 
* smiles:
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
+
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** uhsgpdmiqqynax-uhfffaoysa-l
+
** mhuwzntuiifhas-dssvuwshsa-l
 
* molecular-weight:
 
* molecular-weight:
** 566.699
+
** 698.959
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPPGO]]
+
* [[RXN-15068]]
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[RXN-15043]]
* [[RXN0-1461]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrinogen ix}}
+
{{#set: common-name=dioleoyl phosphatidate}}
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}}
{{#set: molecular-weight=566.699}}
+
{{#set: molecular-weight=698.959}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-8268

  • common-name:
    • dioleoyl phosphatidate
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
  • inchi-key:
    • mhuwzntuiifhas-dssvuwshsa-l
  • molecular-weight:
    • 698.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality