Difference between revisions of "N-SUCCINYL-2-AMINO-6-KETOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7257 == * common-name: ** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa * smiles: ** cc(ccc(=o)c(c)c(sccnc(...")
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-7257 ==
+
== Metabolite MANNOSE-1P ==
 
* common-name:
 
* common-name:
−
** 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa
+
** α-d-mannose 1-phosphate
 
* smiles:
 
* smiles:
−
** cc(ccc(=o)c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
−
** awlxqjgpnlctlm-yfxotmpnsa-j
+
** hxxfsfrbohsimq-rwopyejcsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 1210.128
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.3.1.176-RXN]]
+
* [[MANNPGUANYLTRANGDP-RXN]]
 +
* [[PHOSMANMUT-RXN]]
 +
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 +
* [[RXN4FS-12]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MANNPGUANYLTRANGDP-RXN]]
 +
* [[PHOSMANMUT-RXN]]
 +
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl coa}}
+
{{#set: common-name=α-d-mannose 1-phosphate}}
−
{{#set: inchi-key=inchikey=awlxqjgpnlctlm-yfxotmpnsa-j}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}}
−
{{#set: molecular-weight=1210.128}}
+
{{#set: molecular-weight=258.121}}

Revision as of 14:56, 5 January 2021

Metabolite MANNOSE-1P

  • common-name:
    • α-d-mannose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-rwopyejcsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-SUCCINYL-2-AMINO-6-KETOPIMELATE&oldid=59929"