Difference between revisions of "N-terminal-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...")
(Created page with "Category:metabolite == Metabolite O-Long-Chain-Acyl-L-Carnitines == * common-name: ** an o-long-chain-acyl-l-carnitine == Reaction(s) known to consume the compound == * ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ALPHA-ACETYLORNITHINE ==
+
== Metabolite O-Long-Chain-Acyl-L-Carnitines ==
 
* common-name:
 
* common-name:
** n-acetyl-l-ornithine
+
** an o-long-chain-acyl-l-carnitine
* smiles:
 
** cc(=o)nc(ccc[n+])c(=o)[o-]
 
* inchi-key:
 
** jrlgpaxaghmnol-lurjtmiesa-n
 
* molecular-weight:
 
** 174.199
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLORNDEACET-RXN]]
+
* [[RXN-9918]]
* [[ACETYLORNTRANSAM-RXN]]
 
* [[AODAA]]
 
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLORNDEACET-RXN]]
+
* [[RXN-9918]]
* [[ACETYLORNTRANSAM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-ornithine}}
+
{{#set: common-name=an o-long-chain-acyl-l-carnitine}}
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}
 
{{#set: molecular-weight=174.199}}
 

Revision as of 14:56, 5 January 2021

Metabolite O-Long-Chain-Acyl-L-Carnitines

  • common-name:
    • an o-long-chain-acyl-l-carnitine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality