Difference between revisions of "N1-METHYLADENINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-4101 == * common-name: ** 24-methylenelophenol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34)))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12129 ==
+
== Metabolite CPD-4101 ==
 
* common-name:
 
* common-name:
** menaquinol-12
+
** 24-methylenelophenol
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** fwfjgqgpmzxtlm-wppieqshsa-n
+
** rsmkyrdccsnyfm-aagdoflisa-n
 
* molecular-weight:
 
* molecular-weight:
** 991.617
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.143-RXN]]
 +
* [[RXN-22199]]
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9363]]
+
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-12}}
+
{{#set: common-name=24-methylenelophenol}}
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
+
{{#set: inchi-key=inchikey=rsmkyrdccsnyfm-aagdoflisa-n}}
{{#set: molecular-weight=991.617}}
+
{{#set: molecular-weight=412.698}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-4101

  • common-name:
    • 24-methylenelophenol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • rsmkyrdccsnyfm-aagdoflisa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality