Difference between revisions of "DNA-containing-a-Apyrimidinic-Sites"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-15015 == * common-name: ** 4-hydroxy-2-oxoglutarate == Reaction(s) known to consume the compound == * 4OH2OXOGLUTARALDOL-RXN == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15015 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-hydroxy-2-oxoglutarate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4OH2OXOGLUTARALDOL-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4OH2OXOGLUTARALDOL-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-2-oxoglutarate}} |
| − | |||
| − | |||
Revision as of 14:56, 5 January 2021
Contents
Metabolite CPD-15015
- common-name:
- 4-hydroxy-2-oxoglutarate
