Difference between revisions of "Phenols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FERROCYTOCHROME-B5 == * common-name: ** a ferrocytochrome b5 == Reaction(s) known to consume the compound == <div class="toccolours mw-co...")
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FERROCYTOCHROME-B5 ==
+
== Metabolite CROTONYL-COA ==
 
* common-name:
 
* common-name:
** a ferrocytochrome b5
+
** crotonyl-coa
 +
* smiles:
 +
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 +
* inchi-key:
 +
** kfwwcmjsysspsk-bogfjhsmsa-j
 +
* molecular-weight:
 +
** 831.577
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[ACOAD1f]]
* [[1.14.19.1-RXN]]
+
* [[ACOAR1h]]
* [[1.14.19.3-RXN]]
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
* [[1.14.21.6-RXN]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
* [[1.14.99.33-RXN]]
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
* [[CY_focytb5_LPAREN_c_RPAREN_]]
+
* [[HBCHL]]
* [[PHOSPHATIDYLCHOLINE-DESATURASE-RXN]]
+
* [[HBCHLm]]
* [[RXN-10664]]
+
* [[RXN-11667]]
* [[RXN-11680]]
+
* [[RXN-12558]]
* [[RXN-11681]]
 
* [[RXN-11682]]
 
* [[RXN-11887]]
 
* [[RXN-12755]]
 
* [[RXN-13426]]
 
* [[RXN-13709]]
 
* [[RXN-13712]]
 
* [[RXN-13883]]
 
* [[RXN-13892]]
 
* [[RXN-14491]]
 
* [[RXN-16040]]
 
* [[RXN-16046]]
 
* [[RXN-16065]]
 
* [[RXN-16099]]
 
* [[RXN-16101]]
 
* [[RXN-16132]]
 
* [[RXN-16149]]
 
* [[RXN-16378]]
 
* [[RXN-17105]]
 
* [[RXN-17112]]
 
* [[RXN-4209]]
 
* [[RXN-7796]]
 
* [[RXN-8320]]
 
* [[RXN-8321]]
 
* [[RXN-8322]]
 
* [[RXN-8323]]
 
* [[RXN-8324]]
 
* [[RXN-8325]]
 
* [[RXN-8326]]
 
* [[RXN-8327]]
 
* [[RXN-8328]]
 
* [[RXN-8329]]
 
* [[RXN-8330]]
 
* [[RXN-8331]]
 
* [[RXN-8347]]
 
* [[RXN-8360]]
 
* [[RXN-8361]]
 
* [[RXN-9601]]
 
* [[RXN-9616]]
 
* [[RXN-9669]]
 
* [[RXN3O-218]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
+
* [[ACOA40OR]]
* [[CY_focytb5_LPAREN_c_RPAREN_]]
+
* [[ACOAD1f]]
* [[RXN-16378]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[RXN-11667]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ferrocytochrome b5}}
+
{{#set: common-name=crotonyl-coa}}
 +
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 +
{{#set: molecular-weight=831.577}}

Revision as of 14:56, 5 January 2021

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality