Difference between revisions of "B-Keto-cis-D5-dodecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-292 == * common-name: ** (2e)-hexadecenal * smiles: ** cccccccccccccc=c[ch]=o * inchi-key: ** kljfyxovgvxzkt-ccezhusrsa-n * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-292 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e)-hexadecenal |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccc=c[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kljfyxovgvxzkt-ccezhusrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 238.412 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16656]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3DJ-11230]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e)-hexadecenal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kljfyxovgvxzkt-ccezhusrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=238.412}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-292
- common-name:
- (2e)-hexadecenal
- smiles:
- cccccccccccccc=c[ch]=o
- inchi-key:
- kljfyxovgvxzkt-ccezhusrsa-n
- molecular-weight:
- 238.412
