Difference between revisions of "3-DEHYDRO-SHIKIMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-...")
(Created page with "Category:metabolite == Metabolite PHENYL == * common-name: ** acetophenone * smiles: ** cc(=o)c1(c=cc=cc=1) * inchi-key: ** kwolfjpfchcocg-uhfffaoysa-n * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19726 ==
+
== Metabolite PHENYL ==
 
* common-name:
 
* common-name:
** (4s)-2,3-dehydro-leucocyanidin
+
** acetophenone
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
+
** cc(=o)c1(c=cc=cc=1)
 
* inchi-key:
 
* inchi-key:
** yaagnrwejszflv-zdusscgksa-n
+
** kwolfjpfchcocg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 304.256
+
** 120.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-602]]
+
* [[RXN-1302]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}}
+
{{#set: common-name=acetophenone}}
{{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}}
+
{{#set: inchi-key=inchikey=kwolfjpfchcocg-uhfffaoysa-n}}
{{#set: molecular-weight=304.256}}
+
{{#set: molecular-weight=120.151}}

Revision as of 14:57, 5 January 2021

Metabolite PHENYL

  • common-name:
    • acetophenone
  • smiles:
    • cc(=o)c1(c=cc=cc=1)
  • inchi-key:
    • kwolfjpfchcocg-uhfffaoysa-n
  • molecular-weight:
    • 120.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality