Difference between revisions of "CPD-13533"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7037 == * common-name: ** methionol * smiles: ** csccco * inchi-key: ** czugfkjycpyhhv-uhfffaoysa-n * molecular-weight: ** 106.182 ==...") |
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HYDROXY-METHYL-BUTENYL-DIP == |
* common-name: | * common-name: | ||
− | ** | + | ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mdsizrkjvdmqoq-gorduthdsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 259.069 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HDS]] | ||
+ | * [[IDS1]] | ||
+ | * [[IDS2]] | ||
+ | * [[ISPH2-RXN]] | ||
+ | * [[RXN0-884]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[HDS]] |
+ | * [[RXN-15878]] | ||
+ | * [[RXN0-882]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=259.069}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- common-name:
- (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- smiles:
- cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
- inchi-key:
- mdsizrkjvdmqoq-gorduthdsa-k
- molecular-weight:
- 259.069