Difference between revisions of "Sterol-3-beta-D-glucosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-804 == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hnoajoyerzts...") |
(Created page with "Category:metabolite == Metabolite Benzenediols == * common-name: ** a benzenediol == Reaction(s) known to consume the compound == * LACCASE-RXN == Reaction(s) known to...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Benzenediols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a benzenediol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LACCASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a benzenediol}} |
| − | |||
| − | |||
Revision as of 14:57, 5 January 2021
Contents
Metabolite Benzenediols
- common-name:
- a benzenediol
