Difference between revisions of "16S-rRNA-N6-dimethyladenine1518-1519"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-METHYLCATECHOL == * common-name: ** 4-methylcatechol * smiles: ** cc1(c=cc(o)=c(c=1)o) * inchi-key: ** zbcatmyqydctiz-uhfffaoysa-n * mo...")
(Created page with "Category:metabolite == Metabolite CPD-9873 == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-METHYLCATECHOL ==
+
== Metabolite CPD-9873 ==
 
* common-name:
 
* common-name:
** 4-methylcatechol
+
** 3-demethylubiquinol-10
 
* smiles:
 
* smiles:
** cc1(c=cc(o)=c(c=1)o)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
* inchi-key:
** zbcatmyqydctiz-uhfffaoysa-n
+
** vlmqnhnmqvlpqi-avrcvibksa-n
 
* molecular-weight:
 
* molecular-weight:
** 124.139
+
** 851.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9237]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10078]]
 
* [[RXN-10079]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylcatechol}}
+
{{#set: common-name=3-demethylubiquinol-10}}
{{#set: inchi-key=inchikey=zbcatmyqydctiz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
{{#set: molecular-weight=124.139}}
+
{{#set: molecular-weight=851.347}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-9873

  • common-name:
    • 3-demethylubiquinol-10
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
  • inchi-key:
    • vlmqnhnmqvlpqi-avrcvibksa-n
  • molecular-weight:
    • 851.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality