Difference between revisions of "CPD-9873"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
(Created page with "Category:metabolite == Metabolite Pyrophosphate-inositol-phosphates == * common-name: ** a pyrophosphate-containing inositol phosphate == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14123 ==
+
== Metabolite Pyrophosphate-inositol-phosphates ==
 
* common-name:
 
* common-name:
** 3-amino-2,3-dideoxy-scyllo-inosose
+
** a pyrophosphate-containing inositol phosphate
* smiles:
 
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
 
* inchi-key:
 
** fsugckmutgkwie-ygivhsipsa-o
 
* molecular-weight:
 
** 162.165
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.6.1.52-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13118]]
+
* [[3.6.1.52-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
+
{{#set: common-name=a pyrophosphate-containing inositol phosphate}}
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
 
{{#set: molecular-weight=162.165}}
 

Revision as of 14:57, 5 January 2021

Metabolite Pyrophosphate-inositol-phosphates

  • common-name:
    • a pyrophosphate-containing inositol phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality