Difference between revisions of "CPD-9873"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...") |
(Created page with "Category:metabolite == Metabolite Pyrophosphate-inositol-phosphates == * common-name: ** a pyrophosphate-containing inositol phosphate == Reaction(s) known to consume the...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Pyrophosphate-inositol-phosphates == |
* common-name: | * common-name: | ||
− | ** | + | ** a pyrophosphate-containing inositol phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.6.1.52-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3.6.1.52-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a pyrophosphate-containing inositol phosphate}} |
− | |||
− |
Revision as of 14:57, 5 January 2021
Contents
Metabolite Pyrophosphate-inositol-phosphates
- common-name:
- a pyrophosphate-containing inositol phosphate