Difference between revisions of "GLUCOSAMINYL-ETCETERA-MANNOSYL-R"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...") |
(Created page with "Category:metabolite == Metabolite Protein-N-acetyl-D-glucosamin-L-serine == * common-name: ** an n-acetyl-β-d-glucosaminyl-l-serine-[glycoprotein] == Reaction(s) know...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-N-acetyl-D-glucosamin-L-serine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acetyl-β-d-glucosaminyl-l-serine-[glycoprotein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11889]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11889]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-l-serine-[glycoprotein]}} |
| − | |||
| − | |||
Revision as of 14:57, 5 January 2021
Contents
Metabolite Protein-N-acetyl-D-glucosamin-L-serine
- common-name:
- an n-acetyl-β-d-glucosaminyl-l-serine-[glycoprotein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-l-serine-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
