Difference between revisions of "CPDQT-38"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-650 == * common-name: ** (3r)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-650 ==
+
== Metabolite 3-oxo-D5-steroids ==
 
* common-name:
 
* common-name:
** (3r)-3-hydroxybutanoyl-coa
+
** a 3-oxo-δ5-steroid
* smiles:
 
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 
* inchi-key:
 
** qhhkkmyhdbrony-wzzmxtmrsa-j
 
* molecular-weight:
 
** 849.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.145-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5901]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-3-hydroxybutanoyl-coa}}
+
{{#set: common-name=a 3-oxo-δ5-steroid}}
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-wzzmxtmrsa-j}}
 
{{#set: molecular-weight=849.593}}
 

Revision as of 14:57, 5 January 2021

Metabolite 3-oxo-D5-steroids

  • common-name:
    • a 3-oxo-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality