Difference between revisions of "3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7032 == * common-name: ** 3-methylbutanol * smiles: ** cc(cco)c * inchi-key: ** phtqwckdnzkarw-uhfffaoysa-n * molecular-weight: ** 88...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SHIKIMATE-5P == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** shikimate 3-phosphate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qyojskgcwnakgw-pbxrrbtrsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 251.109 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.5.1.19-RXN]] |
| + | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.5.1.19-RXN]] |
| + | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=shikimate 3-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=251.109}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite SHIKIMATE-5P
- common-name:
- shikimate 3-phosphate
- smiles:
- c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
- inchi-key:
- qyojskgcwnakgw-pbxrrbtrsa-k
- molecular-weight:
- 251.109
