Difference between revisions of "5-2-me-oxy-2-oxo-et-ur-34-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * smiles: ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o * inc...") |
(Created page with "Category:metabolite == Metabolite 3-Oxo-Delta-4-Steroids == * common-name: ** a 3-oxo-δ4-steroid == Reaction(s) known to consume the compound == * 1.3.99.5-RXN *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Oxo-Delta-4-Steroids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-δ4-steroid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.3.99.5-RXN]] |
| + | * [[RXN-13682]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13682]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-δ4-steroid}} |
| − | |||
| − | |||
Revision as of 14:58, 5 January 2021
Contents
Metabolite 3-Oxo-Delta-4-Steroids
- common-name:
- a 3-oxo-δ4-steroid
