Difference between revisions of "1516-DIHYDROBILIVERDIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite CPD-13040 == * common-name: ** 1,2-dibutyrin * smiles: ** cccc(occ(oc(ccc)=o)co)=o * inchi-key: ** awhaupzhzyuhom-vifpvbqesa-n * molecula...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-13040 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1,2-dibutyrin |
* smiles: | * smiles: | ||
− | ** | + | ** cccc(occ(oc(ccc)=o)co)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** awhaupzhzyuhom-vifpvbqesa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 232.276 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12086]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1,2-dibutyrin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=awhaupzhzyuhom-vifpvbqesa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=232.276}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-13040
- common-name:
- 1,2-dibutyrin
- smiles:
- cccc(occ(oc(ccc)=o)co)=o
- inchi-key:
- awhaupzhzyuhom-vifpvbqesa-n
- molecular-weight:
- 232.276