Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-dodec-3-enoyl-ACPs == * common-name: ** a (3z)-dodec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16615 ==...") |
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NMNH == |
* common-name: | * common-name: | ||
− | ** | + | ** reduced β-nicotinamide d-ribonucleotide |
+ | * smiles: | ||
+ | ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o) | ||
+ | * inchi-key: | ||
+ | ** xqhmusrslnrvga-turqnecasa-l | ||
+ | * molecular-weight: | ||
+ | ** 334.222 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-4401]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=reduced β-nicotinamide d-ribonucleotide}} |
+ | {{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}} | ||
+ | {{#set: molecular-weight=334.222}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite NMNH
- common-name:
- reduced β-nicotinamide d-ribonucleotide
- smiles:
- c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
- inchi-key:
- xqhmusrslnrvga-turqnecasa-l
- molecular-weight:
- 334.222