Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zrjhlgyvucpznh-mqwkrirwsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 205.276 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9896]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=205.276}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE
- common-name:
- 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
- smiles:
- c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
- inchi-key:
- zrjhlgyvucpznh-mqwkrirwsa-o
- molecular-weight:
- 205.276
