Difference between revisions of "CPD-15152"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...") |
(Created page with "Category:metabolite == Metabolite Adenine-37-tRNA-Alas == * common-name: ** an adenine37 in trnaala == Reaction(s) known to consume the compound == * RXN-13996 == Reac...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Adenine-37-tRNA-Alas == |
* common-name: | * common-name: | ||
− | ** | + | ** an adenine37 in trnaala |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-13996]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13996]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an adenine37 in trnaala}} |
− | |||
− |
Revision as of 14:58, 5 January 2021
Contents
Metabolite Adenine-37-tRNA-Alas
- common-name:
- an adenine37 in trnaala