Difference between revisions of "1-PALMITOYLGLYCEROL-3-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-N == * common-name: ** dnan == Reaction(s) known to consume the compound == * 3.1.11.1-RXN * 3.1.11.2-RXN * DNA-DIRECTED-DN...") |
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DPG == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phospho-d-glyceroyl-phosphate |
| + | * smiles: | ||
| + | ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** ljqlqcaxbuheaz-uwtatzphsa-j | ||
| + | * molecular-weight: | ||
| + | ** 262.006 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
| − | * [[ | + | * [[GAPDHSYNEC-RXN]] |
| − | * [[ | + | * [[GAPDH_]] |
| − | * [[ | + | * [[GAPOXNPHOSPHN-RXN]] |
| − | * [[ | + | * [[PHOSGLYPHOS-RXN]] |
| + | * [[RXN-17274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GAPDHSYNEC-RXN]] |
| − | * [[ | + | * [[GAPDH_]] |
| − | + | * [[GAPOXNPHOSPHN-RXN]] | |
| − | + | * [[PHOSGLYPHOS-RXN]] | |
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phospho-d-glyceroyl-phosphate}} |
| + | {{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}} | ||
| + | {{#set: molecular-weight=262.006}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite DPG
- common-name:
- 3-phospho-d-glyceroyl-phosphate
- smiles:
- c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
- inchi-key:
- ljqlqcaxbuheaz-uwtatzphsa-j
- molecular-weight:
- 262.006
