Difference between revisions of "T2-DECENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * smiles: ** cc(=o)nc1(c(n)oc(co)c(o)c(o)1) * inch...") |
(Created page with "Category:metabolite == Metabolite 3-MERCAPTO-PYRUVATE == * common-name: ** 3-mercaptopyruvate * smiles: ** c(c(c(=o)[o-])=o)s * inchi-key: ** ojolfaigoxzbci-uhfffaoysa-m *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-MERCAPTO-PYRUVATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-mercaptopyruvate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(c(=o)[o-])=o)s |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ojolfaigoxzbci-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 119.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] | ||
+ | * [[MERCAPYSTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-mercaptopyruvate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ojolfaigoxzbci-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=119.115}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite 3-MERCAPTO-PYRUVATE
- common-name:
- 3-mercaptopyruvate
- smiles:
- c(c(c(=o)[o-])=o)s
- inchi-key:
- ojolfaigoxzbci-uhfffaoysa-m
- molecular-weight:
- 119.115