Difference between revisions of "CPD-190"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYLMALEATE == * common-name: ** citraconate * smiles: ** cc(=cc(=o)[o-])c(=o)[o-] * inchi-key: ** hnegqiomvppmnr-ihwypqmzsa-l * mole...")
(Created page with "Category:metabolite == Metabolite CPD-17373 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate * smiles: ** c(o)cccccccc=ccccccccc(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYLMALEATE ==
+
== Metabolite CPD-17373 ==
 
* common-name:
 
* common-name:
** citraconate
+
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** cc(=cc(=o)[o-])c(=o)[o-]
+
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** hnegqiomvppmnr-ihwypqmzsa-l
+
** zxbgeihfxphrjy-nkfdzxfusa-l
 
* molecular-weight:
 
* molecular-weight:
** 128.084
+
** 728.942
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
+
* [[RXN-16121]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
+
* [[RXN-16118]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=citraconate}}
+
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=hnegqiomvppmnr-ihwypqmzsa-l}}
+
{{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}}
{{#set: molecular-weight=128.084}}
+
{{#set: molecular-weight=728.942}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-17373

  • common-name:
    • 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
  • smiles:
    • c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
  • inchi-key:
    • zxbgeihfxphrjy-nkfdzxfusa-l
  • molecular-weight:
    • 728.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.