Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite CPD-12905 == * common-name: ** 3-hydroxy-5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11403 ==
+
== Metabolite CPD-12905 ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate
+
** 3-hydroxy-5-methylhex-4-enoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
+
** cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ppjyssnksxavdb-uhfffaoysa-m
+
** olzynlskrkfujc-fpviqycmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 746.825
+
** 889.657
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10616]]
 
* [[RXN-10617]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11919]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate}}
+
{{#set: common-name=3-hydroxy-5-methylhex-4-enoyl-coa}}
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=olzynlskrkfujc-fpviqycmsa-j}}
{{#set: molecular-weight=746.825}}
+
{{#set: molecular-weight=889.657}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-12905

  • common-name:
    • 3-hydroxy-5-methylhex-4-enoyl-coa
  • smiles:
    • cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • olzynlskrkfujc-fpviqycmsa-j
  • molecular-weight:
    • 889.657

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality