Difference between revisions of "CPD-15425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-abasic-Sites == * common-name: ** a dna containing an apurinic/apyrimidinic site == Reaction(s) known to consume the compo...")
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-containing-abasic-Sites ==
+
== Metabolite CPD-380 ==
 
* common-name:
 
* common-name:
** a dna containing an apurinic/apyrimidinic site
+
** 3-sulfopyruvate
 +
* smiles:
 +
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
 +
* inchi-key:
 +
** buthmsuebypmkj-uhfffaoysa-l
 +
* molecular-weight:
 +
** 166.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.99.18-RXN]]
+
* [[R230-RXN]]
 +
* [[RXN-11737]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R230-RXN]]
 +
* [[RXN-11737]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dna containing an apurinic/apyrimidinic site}}
+
{{#set: common-name=3-sulfopyruvate}}
 +
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
 +
{{#set: molecular-weight=166.105}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-380

  • common-name:
    • 3-sulfopyruvate
  • smiles:
    • c(=o)([o-])c(=o)cs(=o)(=o)[o-]
  • inchi-key:
    • buthmsuebypmkj-uhfffaoysa-l
  • molecular-weight:
    • 166.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality