Difference between revisions of "TRNAs-with-queuine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-untfvmjosa-n * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-369 ==
+
== Metabolite CPD-11690 ==
 
* common-name:
 
* common-name:
** l-iditol
+
** 1-oleoyl-sn-glycerol
 
* smiles:
 
* smiles:
** c(c(c(c(c(o)co)o)o)o)o
+
** ccccccccc=ccccccccc(=o)occ(co)o
 
* inchi-key:
 
* inchi-key:
** fbpfztcfmrresa-untfvmjosa-n
+
** rzrnayuhwvfmip-qjrazlaksa-n
 
* molecular-weight:
 
* molecular-weight:
** 182.173
+
** 356.545
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[RXN-15089]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-iditol}}
+
{{#set: common-name=1-oleoyl-sn-glycerol}}
{{#set: inchi-key=inchikey=fbpfztcfmrresa-untfvmjosa-n}}
+
{{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}}
{{#set: molecular-weight=182.173}}
+
{{#set: molecular-weight=356.545}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-11690

  • common-name:
    • 1-oleoyl-sn-glycerol
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(co)o
  • inchi-key:
    • rzrnayuhwvfmip-qjrazlaksa-n
  • molecular-weight:
    • 356.545

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality