Difference between revisions of "Pyruvate-Dehydrogenase-Phosphoserine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1812 == * common-name: ** 2-oleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)oc(co)co * inchi-key: ** upwgqkdvauruge-ktkrtigzsa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-17352 == * smiles: ** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z,17z)-icosatrienoate ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17352 == |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid] | ||
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-(11z,14z,17z)-icosatrienoate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16101]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-(11z,14z,17z)-icosatrienoate}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-17352
- smiles:
- ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid]
- common-name:
- a [glycerolipid]-(11z,14z,17z)-icosatrienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-(11z,14z,17z)-icosatrienoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
