Difference between revisions of "DIACYLGLYCEROL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...")
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL-PYRUVATE ==
+
== Metabolite GLC ==
 
* common-name:
 
* common-name:
** keto-phenylpyruvate
+
** β-d-glucopyranose
 
* smiles:
 
* smiles:
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** btnmpgbkdvtsjy-uhfffaoysa-m
+
** wqzgkkkjijffok-vfuothlcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 163.152
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
* [[PREPHENATEDEHYDRAT-RXN]]
+
* [[biomass_rxn]]
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
+
* [[3.2.1.106-RXN]]
* [[PHEAMINOTRANS-RXN]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
* [[PPDH]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
* [[PREPHENATEDEHYDRAT-RXN]]
+
* [[TREHALA-RXN]]
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-phenylpyruvate}}
+
{{#set: common-name=β-d-glucopyranose}}
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}}
{{#set: molecular-weight=163.152}}
+
{{#set: molecular-weight=180.157}}

Revision as of 14:59, 5 January 2021

Metabolite GLC

  • common-name:
    • β-d-glucopyranose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-vfuothlcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality