Difference between revisions of "2-2-N-linked-Glycan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15382 == * common-name: ** keto-d-fructose * smiles: ** c(o)c(=o)c(o)c(o)c(o)co * inchi-key: ** bjhikxhvcxfqls-uyfozjqfsa-n * molecul...")
(Created page with "Category:metabolite == Metabolite CPD-11400 == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15382 ==
+
== Metabolite CPD-11400 ==
 
* common-name:
 
* common-name:
** keto-d-fructose
+
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
 
* smiles:
 
* smiles:
** c(o)c(=o)c(o)c(o)c(o)co
+
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
* inchi-key:
** bjhikxhvcxfqls-uyfozjqfsa-n
+
** yyfgggcinngole-zdxogfqlsa-m
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 826.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCISOM-RXN]]
 
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 
* [[RXN-7644]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCISOM-RXN]]
+
* [[RXN-10607]]
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 
* [[RXN-7644]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-d-fructose}}
+
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
{{#set: inchi-key=inchikey=bjhikxhvcxfqls-uyfozjqfsa-n}}
+
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=826.095}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-11400

  • common-name:
    • 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
  • smiles:
    • c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
  • inchi-key:
    • yyfgggcinngole-zdxogfqlsa-m
  • molecular-weight:
    • 826.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality