Difference between revisions of "44-DIMETHYL-CHOLESTA-814-24-TRIENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4205 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])...") |
(Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * smiles: ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r,s)-tetrahydrobenzylisoquinoline |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yrycifuzsumaay-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.325 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.1.1.115-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.325}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE
- common-name:
- (r,s)-tetrahydrobenzylisoquinoline
- smiles:
- c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
- inchi-key:
- yrycifuzsumaay-uhfffaoysa-o
- molecular-weight:
- 224.325
