Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
(Created page with "Category:metabolite == Metabolite LYSOSOMAL-ENZYME-D-MANNOSE == * common-name: ** an α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LYSOSOMAL-ENZYME-D-MANNOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** an α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-l-asparaginyl-[lysosomal protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[2.7.8.17-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=an α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-l-asparaginyl-[lysosomal protein]}} |
− | |||
− |
Revision as of 14:59, 5 January 2021
Contents
Metabolite LYSOSOMAL-ENZYME-D-MANNOSE
- common-name:
- an α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-l-asparaginyl-[lysosomal protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an α-d-man-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-l-asparaginyl-[lysosomal protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.