Difference between revisions of "5-AMINO-LEVULINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite Phos-G-protein-coupled-receptors == * common-name: ** a phosphorylated g protein-coupled receptor == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Phos-G-protein-coupled-receptors == |
* common-name: | * common-name: | ||
| − | ** | + | ** a phosphorylated g protein-coupled receptor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.7.11.16-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.16-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a phosphorylated g protein-coupled receptor}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite Phos-G-protein-coupled-receptors
- common-name:
- a phosphorylated g protein-coupled receptor
