Difference between revisions of "Palmitoyl-lipid"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13852 == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Quinones == * common-name: ** a quinone == Reaction(s) known to consume the compound == * QOR-RXN == Reaction(s) known to produce the...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Quinones == |
* common-name: | * common-name: | ||
− | ** | + | ** a quinone |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[QOR-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a quinone}} |
− | |||
− |
Revision as of 15:00, 5 January 2021
Contents
Metabolite Quinones
- common-name:
- a quinone