Difference between revisions of "23S-RRNA-N2-METHYLGUANINE2445"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
(Created page with "Category:metabolite == Metabolite AMINO-ACETONE == * common-name: ** aminoacetone * smiles: ** cc(c[n+])=o * inchi-key: ** bcdgqxumwhrqcb-uhfffaoysa-o * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
+
== Metabolite AMINO-ACETONE ==
 
* common-name:
 
* common-name:
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
+
** aminoacetone
 
* smiles:
 
* smiles:
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
+
** cc(c[n+])=o
 
* inchi-key:
 
* inchi-key:
** vxpbdcbtmskckz-xqhnhvhjsa-m
+
** bcdgqxumwhrqcb-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 351.462
+
** 74.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.197-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.197-RXN]]
+
* [[RXN-14249]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}}
+
{{#set: common-name=aminoacetone}}
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
+
{{#set: inchi-key=inchikey=bcdgqxumwhrqcb-uhfffaoysa-o}}
{{#set: molecular-weight=351.462}}
+
{{#set: molecular-weight=74.102}}

Revision as of 15:00, 5 January 2021

Metabolite AMINO-ACETONE

  • common-name:
    • aminoacetone
  • smiles:
    • cc(c[n+])=o
  • inchi-key:
    • bcdgqxumwhrqcb-uhfffaoysa-o
  • molecular-weight:
    • 74.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality