Difference between revisions of "Long-Chain-3S-Hydroxyacyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate == Reaction(s) known to con...")
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE ==
+
== Metabolite CPD-782 ==
 
* common-name:
 
* common-name:
** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate
+
** 3,4-dihydroxyphenylacetate
 +
* smiles:
 +
** c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
 +
* inchi-key:
 +
** cffzdzcdufsofz-uhfffaoysa-m
 +
* molecular-weight:
 +
** 167.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.67-RXN]]
 
* [[RXN-10036]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN6666-5]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate}}
+
{{#set: common-name=3,4-dihydroxyphenylacetate}}
 +
{{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}}
 +
{{#set: molecular-weight=167.141}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-782

  • common-name:
    • 3,4-dihydroxyphenylacetate
  • smiles:
    • c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
  • inchi-key:
    • cffzdzcdufsofz-uhfffaoysa-m
  • molecular-weight:
    • 167.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality