Difference between revisions of "TRNA-Containing-N2-Methylgua-26-Gua27"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-10600 ==
+
== Metabolite AMINO-PARATHION ==
 
* common-name:
 
* common-name:
−
** 4-hydroxybenzoyl-acetyl-coa
+
** amino-parathion
 
* smiles:
 
* smiles:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
 
* inchi-key:
 
* inchi-key:
−
** ovqojjjxnyhopr-fueukbnzsa-j
+
** xizotxgjxstqdi-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 925.647
+
** 261.275
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11246]]
+
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11245]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
+
{{#set: common-name=amino-parathion}}
−
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
+
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
−
{{#set: molecular-weight=925.647}}
+
{{#set: molecular-weight=261.275}}

Revision as of 15:00, 5 January 2021

Metabolite AMINO-PARATHION

  • common-name:
    • amino-parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)n))(occ)=s
  • inchi-key:
    • xizotxgjxstqdi-uhfffaoysa-n
  • molecular-weight:
    • 261.275

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-Containing-N2-Methylgua-26-Gua27&oldid=61618"