Difference between revisions of "COBALT-SIROHYDROCHLORIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNAPhe-wybutosine == * common-name: ** wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DGDP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dgdp |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** cikgwctvfsrmju-kvqbguixsa-k | ||
| + | * molecular-weight: | ||
| + | ** 424.18 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDGD]] | ||
| + | * [[DGDPKIN-RXN]] | ||
| + | * [[DGTPtm]] | ||
| + | * [[RXN-14207]] | ||
| + | * [[RXN-14218]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ATDGM]] |
| + | * [[DGOTO]] | ||
| + | * [[DGTCY]] | ||
| + | * [[DGTPtm]] | ||
| + | * [[DGTUP]] | ||
| + | * [[GDPREDUCT-RXN]] | ||
| + | * [[RXN-14217]] | ||
| + | * [[RXN0-748]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dgdp}} |
| + | {{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}} | ||
| + | {{#set: molecular-weight=424.18}} | ||
Revision as of 15:00, 5 January 2021
Contents
Metabolite DGDP
- common-name:
- dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- cikgwctvfsrmju-kvqbguixsa-k
- molecular-weight:
- 424.18
