Difference between revisions of "CPD-5923"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15016 == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([o-])=o)c(c([o-])=o)o * inchi-key: ** wxskvkpsmahcsg-r...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine methyl ester == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein] c-terminal s-farnesyl-l-cysteine methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8409]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.100-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine methyl ester}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite PROTEIN-C-TERMINAL-S-FARNESYL-L-CYSTEINE
- common-name:
- a [protein] c-terminal s-farnesyl-l-cysteine methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein] c-terminal s-farnesyl-l-cysteine methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
